C35H46N4O4 — CID 67872187
[1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxo-2-(9H-pyrido[3,4-b]indol-3-ylmethyl)dodecan-2-yl] carbamate (PubChem CID 67872187) has the molecular formula C35H46N4O4 and a molecular weight of 586.78 g/mol. Its IUPAC name is [1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxo-2-(9H-pyrido[3,4-b]indol-3-ylmethyl)dodecan-2-yl] carbamate.
| Compound Name | [1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxo-2-(9H-pyrido[3,4-b]indol-3-ylmethyl)dodecan-2-yl] carbamate |
|---|---|
| PubChem CID | 67872187 |
| Molecular Formula | C35H46N4O4 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | [1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxo-2-(9H-pyrido[3,4-b]indol-3-ylmethyl)dodecan-2-yl] carbamate |
| SMILES | CCCCCCCCC(C)CC(Cc1cc2c(cn1)[nH]c1ccccc12)(OC(N)=O)C(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C35H46N4O4/c1-3-4-5-6-7-9-14-25(2)21-35(43-34(36)42,33(41)38-28(24-40)19-26-15-10-8-11-16-26)22-27-20-30-29-17-12-13-18-31(29)39-32(30)23-37-27/h8,10-13,15-18,20,23,25,28,39-40H,3-7,9,14,19,21-22,24H2,1-2H3,(H2,36,42)(H,38,41) |
| InChIKey | QQXVAKYMXMGZJH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|