C36H48N2O3 — CID 67877784
4-[3-[2-[6-[4-(4-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid (PubChem CID 67877784) has the molecular formula C36H48N2O3 and a molecular weight of 556.79 g/mol. Its IUPAC name is 4-[3-[2-[6-[4-(4-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid.
| Compound Name | 4-[3-[2-[6-[4-(4-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid |
|---|---|
| PubChem CID | 67877784 |
| Molecular Formula | C36H48N2O3 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 4-[3-[2-[6-[4-(4-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid |
| SMILES | CCCCc1ccc(CCCCOCc2cccc(C=Cc3cccc(NCCC(CC)(CC)C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C36H48N2O3/c1-4-7-12-29-18-20-30(21-19-29)13-8-9-26-41-28-34-17-11-15-32(38-34)23-22-31-14-10-16-33(27-31)37-25-24-36(5-2,6-3)35(39)40/h10-11,14-23,27,37H,4-9,12-13,24-26,28H2,1-3H3,(H,39,40) |
| InChIKey | OXQKJYZRJVMOLH-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|