C14H6BF2N2O3S — CID 67883209
CID 67883209 (PubChem CID 67883209) has the molecular formula C14H6BF2N2O3S and a molecular weight of 331.09 g/mol.
| Compound Name | CID 67883209 |
|---|---|
| PubChem CID | 67883209 |
| Molecular Formula | C14H6BF2N2O3S |
| Molecular Weight | 331.09 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | — |
| SMILES | C/N=c1/c2c(F)c(F)cc3c(=O)c([B]C(=O)O)c4scc1n4c32 |
| InChI | InChI=1S/C14H6BF2N2O3S/c1-18-10-6-3-23-13-8(15-14(21)22)12(20)4-2-5(16)9(17)7(10)11(4)19(6)13/h2-3H,1H3,(H,21,22)/b18-10+ |
| InChIKey | SUYPQLZVCYDSEX-VCHYOVAHSA-N |
| XLogP | 1.36 |
| TPSA | 71.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.09 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|