C25H23FN4O4S — CID 70280784
[10-[1-(aminomethyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-9-fluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaen-5-yl] hydrogen carbonate (PubChem CID 70280784) has the molecular formula C25H23FN4O4S and a molecular weight of 494.55 g/mol. Its IUPAC name is [10-[1-(aminomethyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-9-fluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaen-5-yl] hydrogen carbonate.
| Compound Name | [10-[1-(aminomethyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-9-fluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaen-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70280784 |
| Molecular Formula | C25H23FN4O4S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [10-[1-(aminomethyl)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-9-fluoro-14-methylimino-6-oxo-3-thia-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,4,7,9,11-pentaen-5-yl] hydrogen carbonate |
| SMILES | C/N=c1/c2c(N3CC4C5C=CC(CN)(CC5)C4C3)c(F)cc3c(=O)c(OC(=O)O)c4scc1n4c32 |
| InChI | InChI=1S/C25H23FN4O4S/c1-28-18-16-9-35-23-22(34-24(32)33)21(31)12-6-15(26)20(17(18)19(12)30(16)23)29-7-13-11-2-4-25(10-27,5-3-11)14(13)8-29/h2,4,6,9,11,13-14H,3,5,7-8,10,27H2,1H3,(H,32,33)/b28-18+ |
| InChIKey | GUEYDSNPNRIGDO-MTDXEUNCSA-N |
| XLogP | 3.25 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|