C18H21N3O5S — CID 67883880
2-[2-[2-(4-sulfamoylphenyl)ethylamino]-1H-indol-3-yl]acetic acid;hydrate (PubChem CID 67883880) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[2-[2-(4-sulfamoylphenyl)ethylamino]-1H-indol-3-yl]acetic acid;hydrate.
| Compound Name | 2-[2-[2-(4-sulfamoylphenyl)ethylamino]-1H-indol-3-yl]acetic acid;hydrate |
|---|---|
| PubChem CID | 67883880 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[2-[2-(4-sulfamoylphenyl)ethylamino]-1H-indol-3-yl]acetic acid;hydrate |
| SMILES | NS(=O)(=O)c1ccc(CCNc2[nH]c3ccccc3c2CC(=O)O)cc1.O |
| InChI | InChI=1S/C18H19N3O4S.H2O/c19-26(24,25)13-7-5-12(6-8-13)9-10-20-18-15(11-17(22)23)14-3-1-2-4-16(14)21-18;/h1-8,20-21H,9-11H2,(H,22,23)(H2,19,24,25);1H2 |
| InChIKey | IQCCWMSPSRSENS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 156.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |