C24H22F3KN7 — CID 67885779
CID 67885779 (PubChem CID 67885779) has the molecular formula C24H22F3KN7 and a molecular weight of 504.58 g/mol.
| Compound Name | CID 67885779 |
|---|---|
| PubChem CID | 67885779 |
| Molecular Formula | C24H22F3KN7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1nc2c(c(NCc3ccc(-c4ccccc4-c4nn[nH]n4)cc3)n1)CCCCC2.[K] |
| InChI | InChI=1S/C24H22F3N7.K/c25-24(26,27)23-29-20-9-3-1-2-8-19(20)21(30-23)28-14-15-10-12-16(13-11-15)17-6-4-5-7-18(17)22-31-33-34-32-22;/h4-7,10-13H,1-3,8-9,14H2,(H,28,29,30)(H,31,32,33,34); |
| InChIKey | UCMCPYLEGLYDBK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |