C23H18O4S — CID 67891174
(10,10-dioxo-9-phenylthioxanthen-9-yl) 2-methylprop-2-enoate (PubChem CID 67891174) has the molecular formula C23H18O4S and a molecular weight of 390.46 g/mol. Its IUPAC name is (10,10-dioxo-9-phenylthioxanthen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (10,10-dioxo-9-phenylthioxanthen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67891174 |
| Molecular Formula | C23H18O4S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (10,10-dioxo-9-phenylthioxanthen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(c2ccccc2)c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C23H18O4S/c1-16(2)22(24)27-23(17-10-4-3-5-11-17)18-12-6-8-14-20(18)28(25,26)21-15-9-7-13-19(21)23/h3-15H,1H2,2H3 |
| InChIKey | MSCKHBIAVYEKEN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|