C12H24O3 — CID 67891277
(4S,5R)-2-ethyl-5-(methoxymethyl)-2,4,5-trimethyloxan-4-ol (PubChem CID 67891277) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (4S,5R)-2-ethyl-5-(methoxymethyl)-2,4,5-trimethyloxan-4-ol.
| Compound Name | (4S,5R)-2-ethyl-5-(methoxymethyl)-2,4,5-trimethyloxan-4-ol |
|---|---|
| PubChem CID | 67891277 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (4S,5R)-2-ethyl-5-(methoxymethyl)-2,4,5-trimethyloxan-4-ol |
| SMILES | CCC1(C)C[C@](C)(O)[C@](C)(COC)CO1 |
| InChI | InChI=1S/C12H24O3/c1-6-11(3)7-12(4,13)10(2,8-14-5)9-15-11/h13H,6-9H2,1-5H3/t10-,11?,12+/m1/s1 |
| InChIKey | SCMKDLROBUWIMU-LWALXPGCSA-N |
| XLogP | 1.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |