C27H28ClNO — CID 67893663
1-[4-[chloro(phenyl)methyl]phenyl]-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-ol (PubChem CID 67893663) has the molecular formula C27H28ClNO and a molecular weight of 417.98 g/mol. Its IUPAC name is 1-[4-[chloro(phenyl)methyl]phenyl]-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-ol.
| Compound Name | 1-[4-[chloro(phenyl)methyl]phenyl]-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 67893663 |
| Molecular Formula | C27H28ClNO |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-[4-[chloro(phenyl)methyl]phenyl]-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-ol |
| SMILES | OC(CCN1CC=C(c2ccccc2)CC1)c1ccc(C(Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28ClNO/c28-27(24-9-5-2-6-10-24)25-13-11-23(12-14-25)26(30)17-20-29-18-15-22(16-19-29)21-7-3-1-4-8-21/h1-15,26-27,30H,16-20H2 |
| InChIKey | KVZSEUYSFMYXRB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|