C20H23NO — CID 67894801
(3aS,5S,9bR)-5-(3-methoxyphenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole (PubChem CID 67894801) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (3aS,5S,9bR)-5-(3-methoxyphenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole.
| Compound Name | (3aS,5S,9bR)-5-(3-methoxyphenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 67894801 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (3aS,5S,9bR)-5-(3-methoxyphenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
| SMILES | COc1cccc([C@@H]2C[C@H]3[C@H](CCN3C)c3ccccc32)c1 |
| InChI | InChI=1S/C20H23NO/c1-21-11-10-18-16-8-3-4-9-17(16)19(13-20(18)21)14-6-5-7-15(12-14)22-2/h3-9,12,18-20H,10-11,13H2,1-2H3/t18-,19+,20+/m1/s1 |
| InChIKey | LADBKQVETUQTBI-AABGKKOBSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |