C21H36O2 — CID 67898910
1-[[(Z)-but-1-enoxy]methyl]-4-[4-(prop-2-enoxymethyl)cyclohexyl]cyclohexane (PubChem CID 67898910) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-[[(Z)-but-1-enoxy]methyl]-4-[4-(prop-2-enoxymethyl)cyclohexyl]cyclohexane.
| Compound Name | 1-[[(Z)-but-1-enoxy]methyl]-4-[4-(prop-2-enoxymethyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 67898910 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 1-[[(Z)-but-1-enoxy]methyl]-4-[4-(prop-2-enoxymethyl)cyclohexyl]cyclohexane |
| SMILES | C=CCOCC1CCC(C2CCC(CO/C=C\CC)CC2)CC1 |
| InChI | InChI=1S/C21H36O2/c1-3-5-15-23-17-19-8-12-21(13-9-19)20-10-6-18(7-11-20)16-22-14-4-2/h4-5,15,18-21H,2-3,6-14,16-17H2,1H3/b15-5- |
| InChIKey | BIRMFWWKKKWCPZ-WCSRMQSCSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|