C10H8N4O — CID 67901452
3-(2H-triazol-4-yl)-2H-1,2-benzoxazine (PubChem CID 67901452) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-(2H-triazol-4-yl)-2H-1,2-benzoxazine.
| Compound Name | 3-(2H-triazol-4-yl)-2H-1,2-benzoxazine |
|---|---|
| PubChem CID | 67901452 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3-(2H-triazol-4-yl)-2H-1,2-benzoxazine |
| SMILES | C1=C(c2cn[nH]n2)NOc2ccccc21 |
| InChI | InChI=1S/C10H8N4O/c1-2-4-10-7(3-1)5-8(13-15-10)9-6-11-14-12-9/h1-6,13H,(H,11,12,14) |
| InChIKey | PZXGULIBCYSVPE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |