C11H15NOSi — CID 175984014
2H-1,2-benzoxazin-3-yl(trimethyl)silane (PubChem CID 175984014) has the molecular formula C11H15NOSi and a molecular weight of 205.33 g/mol. Its IUPAC name is 2H-1,2-benzoxazin-3-yl(trimethyl)silane.
| Compound Name | 2H-1,2-benzoxazin-3-yl(trimethyl)silane |
|---|---|
| PubChem CID | 175984014 |
| Molecular Formula | C11H15NOSi |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2H-1,2-benzoxazin-3-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)C1=Cc2ccccc2ON1 |
| InChI | InChI=1S/C11H15NOSi/c1-14(2,3)11-8-9-6-4-5-7-10(9)13-12-11/h4-8,12H,1-3H3 |
| InChIKey | LYBWUHMGFYPUHF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|