About 2H-1,2-benzoxazin-3-yl(trimethyl)silane
2H-1,2-benzoxazin-3-yl(trimethyl)silane (PubChem CID 175984014) has the molecular formula C11H15NOSi
and a molecular weight of 205.33 g/mol. Its IUPAC name is 2H-1,2-benzoxazin-3-yl(trimethyl)silane.
Molecular Properties
| Compound Name | 2H-1,2-benzoxazin-3-yl(trimethyl)silane |
| PubChem CID | 175984014 |
| Molecular Formula | C11H15NOSi |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2H-1,2-benzoxazin-3-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)C1=Cc2ccccc2ON1 |
| InChI | InChI=1S/C11H15NOSi/c1-14(2,3)11-8-9-6-4-5-7-10(9)13-12-11/h4-8,12H,1-3H3 |
| InChIKey | LYBWUHMGFYPUHF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-1,2-benzoxazin-3-yl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,2-benzoxazin-3-yl(trimethyl)silane?
The IUPAC name of 2H-1,2-benzoxazin-3-yl(trimethyl)silane (CID 175984014) is 2H-1,2-benzoxazin-3-yl(trimethyl)silane.
What is the SMILES notation for 2H-1,2-benzoxazin-3-yl(trimethyl)silane?
The canonical SMILES for 2H-1,2-benzoxazin-3-yl(trimethyl)silane is C[Si](C)(C)C1=Cc2ccccc2ON1.
What is the InChIKey of 2H-1,2-benzoxazin-3-yl(trimethyl)silane?
The InChIKey is LYBWUHMGFYPUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOSi/c1-14(2,3)11-8-9-6-4-5-7-10(9)13-12-11/h4-8,12H,1-3H3.
What are the key properties of 2H-1,2-benzoxazin-3-yl(trimethyl)silane?
2H-1,2-benzoxazin-3-yl(trimethyl)silane has a molecular weight of 205.33 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,2-benzoxazin-3-yl(trimethyl)silane is sourced from PubChem (CID 175984014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).