C13H20Si2 — CID 10036941
(1,1-dimethyl-1-benzosilol-2-yl)-trimethylsilane (PubChem CID 10036941) has the molecular formula C13H20Si2 and a molecular weight of 232.47 g/mol. Its IUPAC name is (1,1-dimethyl-1-benzosilol-2-yl)-trimethylsilane.
| Compound Name | (1,1-dimethyl-1-benzosilol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 10036941 |
| Molecular Formula | C13H20Si2 |
| Molecular Weight | 232.47 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (1,1-dimethyl-1-benzosilol-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=Cc2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C13H20Si2/c1-14(2,3)13-10-11-8-6-7-9-12(11)15(13,4)5/h6-10H,1-5H3 |
| InChIKey | LEJBQNSGMMUGIZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|