C20H30Si — CID 153467803
trimethyl-[(1,1,3,3-tetramethylspiro[cyclobutane-2,1'-indene]-2'-yl)methyl]silane (PubChem CID 153467803) has the molecular formula C20H30Si and a molecular weight of 298.55 g/mol. Its IUPAC name is trimethyl-[(1,1,3,3-tetramethylspiro[cyclobutane-2,1'-indene]-2'-yl)methyl]silane.
| Compound Name | trimethyl-[(1,1,3,3-tetramethylspiro[cyclobutane-2,1'-indene]-2'-yl)methyl]silane |
|---|---|
| PubChem CID | 153467803 |
| Molecular Formula | C20H30Si |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | trimethyl-[(1,1,3,3-tetramethylspiro[cyclobutane-2,1'-indene]-2'-yl)methyl]silane |
| SMILES | CC1(C)CC(C)(C)C12C(C[Si](C)(C)C)=Cc1ccccc12 |
| InChI | InChI=1S/C20H30Si/c1-18(2)14-19(3,4)20(18)16(13-21(5,6)7)12-15-10-8-9-11-17(15)20/h8-12H,13-14H2,1-7H3 |
| InChIKey | CPKOGSRXEGWFCV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|