C31H42Si2 — CID 158643717
CID 158643717 (PubChem CID 158643717) has the molecular formula C31H42Si2 and a molecular weight of 470.85 g/mol.
| Compound Name | CID 158643717 |
|---|---|
| PubChem CID | 158643717 |
| Molecular Formula | C31H42Si2 |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | — |
| SMILES | CCC1=Cc2ccccc2C12CC1(C=C(C[Si](C)(C)C)c3ccccc31)[Si]2(C)CC(C)(C)C |
| InChI | InChI=1S/C31H42Si2/c1-9-25-18-23-14-10-12-16-27(23)31(25)21-30(33(31,8)22-29(2,3)4)19-24(20-32(5,6)7)26-15-11-13-17-28(26)30/h10-19H,9,20-22H2,1-8H3 |
| InChIKey | YVDSAPOEODUHLM-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|