About CID 158643717
CID 158643717 (PubChem CID 158643717) has the molecular formula C31H42Si2
and a molecular weight of 470.85 g/mol.
Molecular Properties
| Compound Name | CID 158643717 |
| PubChem CID | 158643717 |
| Molecular Formula | C31H42Si2 |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | — |
| SMILES | CCC1=Cc2ccccc2C12CC1(C=C(C[Si](C)(C)C)c3ccccc31)[Si]2(C)CC(C)(C)C |
| InChI | InChI=1S/C31H42Si2/c1-9-25-18-23-14-10-12-16-27(23)31(25)21-30(33(31,8)22-29(2,3)4)19-24(20-32(5,6)7)26-15-11-13-17-28(26)30/h10-19H,9,20-22H2,1-8H3 |
| InChIKey | YVDSAPOEODUHLM-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158643717 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158643717?
The IUPAC name of CID 158643717 (CID 158643717) is not available.
What is the SMILES notation for CID 158643717?
The canonical SMILES for CID 158643717 is CCC1=Cc2ccccc2C12CC1(C=C(C[Si](C)(C)C)c3ccccc31)[Si]2(C)CC(C)(C)C.
What is the InChIKey of CID 158643717?
The InChIKey is YVDSAPOEODUHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H42Si2/c1-9-25-18-23-14-10-12-16-27(23)31(25)21-30(33(31,8)22-29(2,3)4)19-24(20-32(5,6)7)26-15-11-13-17-28(26)30/h10-19H,9,20-22H2,1-8H3.
What are the key properties of CID 158643717?
CID 158643717 has a molecular weight of 470.85 g/mol, XLogP of 9.01, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158643717 is sourced from PubChem (CID 158643717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).