C28H37Cl2Si3 — CID 140853130
CID 140853130 (PubChem CID 140853130) has the molecular formula C28H37Cl2Si3 and a molecular weight of 528.77 g/mol.
| Compound Name | CID 140853130 |
|---|---|
| PubChem CID | 140853130 |
| Molecular Formula | C28H37Cl2Si3 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCC1=Cc2ccccc2C1(Cl)[Si](C)(C)C1(Cl)C(C[Si](C)(C)C)=Cc2ccccc21 |
| InChI | InChI=1S/C28H37Cl2Si3/c1-31(2)17-16-23-18-21-12-8-10-14-25(21)27(23,29)33(6,7)28(30)24(20-32(3,4)5)19-22-13-9-11-15-26(22)28/h8-15,18-19H,16-17,20H2,1-7H3 |
| InChIKey | AZOFGPRDRDYZCK-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|