C8H5Cl5OSi2 — CID 631687
trichloro-(2,2-dichloro-1,2-benzoxasilin-3-yl)silane (PubChem CID 631687) has the molecular formula C8H5Cl5OSi2 and a molecular weight of 350.56 g/mol. Its IUPAC name is trichloro-(2,2-dichloro-1,2-benzoxasilin-3-yl)silane.
| Compound Name | trichloro-(2,2-dichloro-1,2-benzoxasilin-3-yl)silane |
|---|---|
| PubChem CID | 631687 |
| Molecular Formula | C8H5Cl5OSi2 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 347.83 |
| IUPAC Name | trichloro-(2,2-dichloro-1,2-benzoxasilin-3-yl)silane |
| SMILES | Cl[Si](Cl)(Cl)C1=Cc2ccccc2O[Si]1(Cl)Cl |
| InChI | InChI=1S/C8H5Cl5OSi2/c9-15(10,11)8-5-6-3-1-2-4-7(6)14-16(8,12)13/h1-5H |
| InChIKey | PLRKLYMLAWRWMG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|