C24H16O8Si2 — CID 154732453
2,2'-spirobi[1,3,2-benzodioxasilole] (PubChem CID 154732453) has the molecular formula C24H16O8Si2 and a molecular weight of 488.56 g/mol. Its IUPAC name is 2,2'-spirobi[1,3,2-benzodioxasilole].
| Compound Name | 2,2'-spirobi[1,3,2-benzodioxasilole] |
|---|---|
| PubChem CID | 154732453 |
| Molecular Formula | C24H16O8Si2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 2,2'-spirobi[1,3,2-benzodioxasilole] |
| SMILES | c1ccc2c(c1)O[Si]1(O2)Oc2ccccc2O1.c1ccc2c(c1)O[Si]1(O2)Oc2ccccc2O1 |
| InChI | InChI=1S/2C12H8O4Si/c2*1-2-6-10-9(5-1)13-17(14-10)15-11-7-3-4-8-12(11)16-17/h2*1-8H |
| InChIKey | HLXXJRSMMFZHDU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|