C7H6BO — CID 66705506
CID 66705506 (PubChem CID 66705506) has the molecular formula C7H6BO and a molecular weight of 116.94 g/mol.
| Compound Name | CID 66705506 |
|---|---|
| PubChem CID | 66705506 |
| Molecular Formula | C7H6BO |
| Molecular Weight | 116.94 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | — |
| SMILES | [B]1COc2ccccc21 |
| InChI | InChI=1S/C7H6BO/c1-2-4-7-6(3-1)8-5-9-7/h1-4H,5H2 |
| InChIKey | ACBHHQDNHGFRGV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.94 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|