C15H16O2Si — CID 15790829
11,11-dimethyl-5H-benzo[d][1,3,2]benzodioxasilocine (PubChem CID 15790829) has the molecular formula C15H16O2Si and a molecular weight of 256.38 g/mol. Its IUPAC name is 11,11-dimethyl-5H-benzo[d][1,3,2]benzodioxasilocine.
| Compound Name | 11,11-dimethyl-5H-benzo[d][1,3,2]benzodioxasilocine |
|---|---|
| PubChem CID | 15790829 |
| Molecular Formula | C15H16O2Si |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 11,11-dimethyl-5H-benzo[d][1,3,2]benzodioxasilocine |
| SMILES | C[Si]1(C)Oc2ccccc2Cc2ccccc2O1 |
| InChI | InChI=1S/C15H16O2Si/c1-18(2)16-14-9-5-3-7-12(14)11-13-8-4-6-10-15(13)17-18/h3-10H,11H2,1-2H3 |
| InChIKey | GQWNJMGZNXSOGC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|