C13H20SiSn — CID 10471414
(1,1-dimethyl-1-benzostannol-2-yl)-trimethylsilane (PubChem CID 10471414) has the molecular formula C13H20SiSn and a molecular weight of 323.10 g/mol. Its IUPAC name is (1,1-dimethyl-1-benzostannol-2-yl)-trimethylsilane.
| Compound Name | (1,1-dimethyl-1-benzostannol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 10471414 |
| Molecular Formula | C13H20SiSn |
| Molecular Weight | 323.10 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (1,1-dimethyl-1-benzostannol-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=Cc2ccccc2[Sn]1(C)C |
| InChI | InChI=1S/C11H14Si.2CH3.Sn/c1-12(2,3)10-9-11-7-5-4-6-8-11;;;/h4-7,9H,1-3H3;2*1H3; |
| InChIKey | WEYQXDOLFOLMPY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|