C23H24SiSn — CID 177494266
(1,1-diphenyl-1-benzostannol-2-yl)-trimethylsilane (PubChem CID 177494266) has the molecular formula C23H24SiSn and a molecular weight of 447.24 g/mol. Its IUPAC name is (1,1-diphenyl-1-benzostannol-2-yl)-trimethylsilane.
| Compound Name | (1,1-diphenyl-1-benzostannol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 177494266 |
| Molecular Formula | C23H24SiSn |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | (1,1-diphenyl-1-benzostannol-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=Cc2ccccc2[Sn]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C11H14Si.2C6H5.Sn/c1-12(2,3)10-9-11-7-5-4-6-8-11;2*1-2-4-6-5-3-1;/h4-7,9H,1-3H3;2*1-5H; |
| InChIKey | UNKHTRUJTAPYML-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|