C34H38Si2Sn — CID 166436968
trimethyl-(1,1,3,4-tetraphenyl-5-trimethylsilylstannol-2-yl)silane (PubChem CID 166436968) has the molecular formula C34H38Si2Sn and a molecular weight of 621.56 g/mol. Its IUPAC name is trimethyl-(1,1,3,4-tetraphenyl-5-trimethylsilylstannol-2-yl)silane.
| Compound Name | trimethyl-(1,1,3,4-tetraphenyl-5-trimethylsilylstannol-2-yl)silane |
|---|---|
| PubChem CID | 166436968 |
| Molecular Formula | C34H38Si2Sn |
| Molecular Weight | 621.56 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | trimethyl-(1,1,3,4-tetraphenyl-5-trimethylsilylstannol-2-yl)silane |
| SMILES | C[Si](C)(C)C1=C(c2ccccc2)C(c2ccccc2)=C([Si](C)(C)C)[Sn]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28Si2.2C6H5.Sn/c1-23(2,3)17-21(19-13-9-7-10-14-19)22(18-24(4,5)6)20-15-11-8-12-16-20;2*1-2-4-6-5-3-1;/h7-16H,1-6H3;2*1-5H; |
| InChIKey | BWHLKWQBZNQGHG-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.56 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|