C23H24GeSi — CID 177415286
(1,1-diphenyl-1-benzogermol-2-yl)-trimethylsilane (PubChem CID 177415286) has the molecular formula C23H24GeSi and a molecular weight of 401.14 g/mol. Its IUPAC name is (1,1-diphenyl-1-benzogermol-2-yl)-trimethylsilane.
| Compound Name | (1,1-diphenyl-1-benzogermol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 177415286 |
| Molecular Formula | C23H24GeSi |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (1,1-diphenyl-1-benzogermol-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=Cc2ccccc2[Ge]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24GeSi/c1-25(2,3)23-18-19-12-10-11-17-22(19)24(23,20-13-6-4-7-14-20)21-15-8-5-9-16-21/h4-18H,1-3H3 |
| InChIKey | FQSCHPMORBPWCO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|