C9H12N2O — CID 22349486
2H-1,2-benzoxazine;methanamine (PubChem CID 22349486) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2H-1,2-benzoxazine;methanamine.
| Compound Name | 2H-1,2-benzoxazine;methanamine |
|---|---|
| PubChem CID | 22349486 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2H-1,2-benzoxazine;methanamine |
| SMILES | C1=Cc2ccccc2ON1.CN |
| InChI | InChI=1S/C8H7NO.CH5N/c1-2-4-8-7(3-1)5-6-9-10-8;1-2/h1-6,9H;2H2,1H3 |
| InChIKey | FDKSQJMZRRIHNE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |