About 2H-1,2-benzoxazine;cyclohexanamine
2H-1,2-benzoxazine;cyclohexanamine (PubChem CID 175182018) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2H-1,2-benzoxazine;cyclohexanamine.
Molecular Properties
| Compound Name | 2H-1,2-benzoxazine;cyclohexanamine |
| PubChem CID | 175182018 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2H-1,2-benzoxazine;cyclohexanamine |
| SMILES | C1=Cc2ccccc2ON1.NC1CCCCC1 |
| InChI | InChI=1S/C8H7NO.C6H13N/c1-2-4-8-7(3-1)5-6-9-10-8;7-6-4-2-1-3-5-6/h1-6,9H;6H,1-5,7H2 |
| InChIKey | CGTBPZHPTGNUJG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,2-benzoxazine;cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,2-benzoxazine;cyclohexanamine?
The IUPAC name of 2H-1,2-benzoxazine;cyclohexanamine (CID 175182018) is 2H-1,2-benzoxazine;cyclohexanamine.
What is the SMILES notation for 2H-1,2-benzoxazine;cyclohexanamine?
The canonical SMILES for 2H-1,2-benzoxazine;cyclohexanamine is C1=Cc2ccccc2ON1.NC1CCCCC1.
What is the InChIKey of 2H-1,2-benzoxazine;cyclohexanamine?
The InChIKey is CGTBPZHPTGNUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.C6H13N/c1-2-4-8-7(3-1)5-6-9-10-8;7-6-4-2-1-3-5-6/h1-6,9H;6H,1-5,7H2.
What are the key properties of 2H-1,2-benzoxazine;cyclohexanamine?
2H-1,2-benzoxazine;cyclohexanamine has a molecular weight of 232.33 g/mol, XLogP of 2.83, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,2-benzoxazine;cyclohexanamine is sourced from PubChem (CID 175182018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).