C11H14N2O3S — CID 118163764
2H-1,2-benzoxazine;prop-1-ene-2-sulfonamide (PubChem CID 118163764) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2H-1,2-benzoxazine;prop-1-ene-2-sulfonamide.
| Compound Name | 2H-1,2-benzoxazine;prop-1-ene-2-sulfonamide |
|---|---|
| PubChem CID | 118163764 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2H-1,2-benzoxazine;prop-1-ene-2-sulfonamide |
| SMILES | C1=Cc2ccccc2ON1.C=C(C)S(N)(=O)=O |
| InChI | InChI=1S/C8H7NO.C3H7NO2S/c1-2-4-8-7(3-1)5-6-9-10-8;1-3(2)7(4,5)6/h1-6,9H;1H2,2H3,(H2,4,5,6) |
| InChIKey | UYXMATAJWITIMN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |