C11H14N2O — CID 175090238
2H-1,2-benzoxazine;prop-2-en-1-amine (PubChem CID 175090238) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2H-1,2-benzoxazine;prop-2-en-1-amine.
| Compound Name | 2H-1,2-benzoxazine;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175090238 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2H-1,2-benzoxazine;prop-2-en-1-amine |
| SMILES | C1=Cc2ccccc2ON1.C=CCN |
| InChI | InChI=1S/C8H7NO.C3H7N/c1-2-4-8-7(3-1)5-6-9-10-8;1-2-3-4/h1-6,9H;2H,1,3-4H2 |
| InChIKey | UEWNHJIAARGILY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|