C11H12N2O2 — CID 159437520
2H-1,2-benzoxazine;4,5-dihydro-1,3-oxazole (PubChem CID 159437520) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2H-1,2-benzoxazine;4,5-dihydro-1,3-oxazole.
| Compound Name | 2H-1,2-benzoxazine;4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 159437520 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2H-1,2-benzoxazine;4,5-dihydro-1,3-oxazole |
| SMILES | C1=Cc2ccccc2ON1.C1=NCCO1 |
| InChI | InChI=1S/C8H7NO.C3H5NO/c1-2-4-8-7(3-1)5-6-9-10-8;1-2-5-3-4-1/h1-6,9H;3H,1-2H2 |
| InChIKey | LRTLLPFPWLCAOK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |