C10H13NO3 — CID 175297892
2H-1,2-benzoxazine;ethane-1,2-diol (PubChem CID 175297892) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2H-1,2-benzoxazine;ethane-1,2-diol.
| Compound Name | 2H-1,2-benzoxazine;ethane-1,2-diol |
|---|---|
| PubChem CID | 175297892 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2H-1,2-benzoxazine;ethane-1,2-diol |
| SMILES | C1=Cc2ccccc2ON1.OCCO |
| InChI | InChI=1S/C8H7NO.C2H6O2/c1-2-4-8-7(3-1)5-6-9-10-8;3-1-2-4/h1-6,9H;3-4H,1-2H2 |
| InChIKey | RBPQCMLHKNHVQM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |