About 2H-1,2-benzoxazine;1H-pyrazole
2H-1,2-benzoxazine;1H-pyrazole (PubChem CID 89454286) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 2H-1,2-benzoxazine;1H-pyrazole.
Molecular Properties
| Compound Name | 2H-1,2-benzoxazine;1H-pyrazole |
| PubChem CID | 89454286 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2H-1,2-benzoxazine;1H-pyrazole |
| SMILES | C1=Cc2ccccc2ON1.c1cn[nH]c1 |
| InChI | InChI=1S/C8H7NO.C3H4N2/c1-2-4-8-7(3-1)5-6-9-10-8;1-2-4-5-3-1/h1-6,9H;1-3H,(H,4,5) |
| InChIKey | POVUHKNBNMEWRA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,2-benzoxazine;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,2-benzoxazine;1H-pyrazole?
The IUPAC name of 2H-1,2-benzoxazine;1H-pyrazole (CID 89454286) is 2H-1,2-benzoxazine;1H-pyrazole.
What is the SMILES notation for 2H-1,2-benzoxazine;1H-pyrazole?
The canonical SMILES for 2H-1,2-benzoxazine;1H-pyrazole is C1=Cc2ccccc2ON1.c1cn[nH]c1.
What is the InChIKey of 2H-1,2-benzoxazine;1H-pyrazole?
The InChIKey is POVUHKNBNMEWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.C3H4N2/c1-2-4-8-7(3-1)5-6-9-10-8;1-2-4-5-3-1/h1-6,9H;1-3H,(H,4,5).
What are the key properties of 2H-1,2-benzoxazine;1H-pyrazole?
2H-1,2-benzoxazine;1H-pyrazole has a molecular weight of 201.23 g/mol, XLogP of 1.96, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,2-benzoxazine;1H-pyrazole is sourced from PubChem (CID 89454286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).