C11H13NO — CID 178028695
6-propan-2-yl-2H-1,2-benzoxazine (PubChem CID 178028695) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-propan-2-yl-2H-1,2-benzoxazine.
| Compound Name | 6-propan-2-yl-2H-1,2-benzoxazine |
|---|---|
| PubChem CID | 178028695 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 6-propan-2-yl-2H-1,2-benzoxazine |
| SMILES | CC(C)c1ccc2c(c1)C=CNO2 |
| InChI | InChI=1S/C11H13NO/c1-8(2)9-3-4-11-10(7-9)5-6-12-13-11/h3-8,12H,1-2H3 |
| InChIKey | GLBHJIUWXCHCPL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |