C31H30N2O — CID 175343992
chrysene;N-pentyl-2H-1,2-benzoxazin-3-amine (PubChem CID 175343992) has the molecular formula C31H30N2O and a molecular weight of 446.59 g/mol. Its IUPAC name is chrysene;N-pentyl-2H-1,2-benzoxazin-3-amine.
| Compound Name | chrysene;N-pentyl-2H-1,2-benzoxazin-3-amine |
|---|---|
| PubChem CID | 175343992 |
| Molecular Formula | C31H30N2O |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | chrysene;N-pentyl-2H-1,2-benzoxazin-3-amine |
| SMILES | CCCCCNC1=Cc2ccccc2ON1.c1ccc2c(c1)ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C18H12.C13H18N2O/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-3-6-9-14-13-10-11-7-4-5-8-12(11)16-15-13/h1-12H;4-5,7-8,10,14-15H,2-3,6,9H2,1H3 |
| InChIKey | ZIMMKEJPZQZNPH-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|