C15H16N2O6 — CID 67905788
benzyl N-[(2S)-1-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 67905788) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67905788 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | benzyl N-[(2S)-1-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)C1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C15H16N2O6/c1-9(13(19)11-7-12(18)17(22)14(11)20)16-15(21)23-8-10-5-3-2-4-6-10/h2-6,9,11,22H,7-8H2,1H3,(H,16,21)/t9-,11?/m0/s1 |
| InChIKey | SBWKUFQOUOOGDD-FTNKSUMCSA-N |
| XLogP | 0.63 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|