C33H52O5Si2 — CID 67906108
[4-[1-(2,2,3,3,6-pentamethyloxadisilinan-5-yl)pentoxy]phenyl] 4-heptoxybenzoate (PubChem CID 67906108) has the molecular formula C33H52O5Si2 and a molecular weight of 584.95 g/mol. Its IUPAC name is [4-[1-(2,2,3,3,6-pentamethyloxadisilinan-5-yl)pentoxy]phenyl] 4-heptoxybenzoate.
| Compound Name | [4-[1-(2,2,3,3,6-pentamethyloxadisilinan-5-yl)pentoxy]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 67906108 |
| Molecular Formula | C33H52O5Si2 |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | [4-[1-(2,2,3,3,6-pentamethyloxadisilinan-5-yl)pentoxy]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(OC(CCCC)C3C[Si](C)(C)[Si](C)(C)OC3C)cc2)cc1 |
| InChI | InChI=1S/C33H52O5Si2/c1-8-10-12-13-14-24-35-28-18-16-27(17-19-28)33(34)37-30-22-20-29(21-23-30)36-32(15-11-9-2)31-25-39(4,5)40(6,7)38-26(31)3/h16-23,26,31-32H,8-15,24-25H2,1-7H3 |
| InChIKey | LFOUAFRCOXNAOZ-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|