C21H25Cl2N3 — CID 67909385
3-[(3,4-dichlorophenyl)methyl]-4-(3-methylbut-2-enyl)-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine (PubChem CID 67909385) has the molecular formula C21H25Cl2N3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-4-(3-methylbut-2-enyl)-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-4-(3-methylbut-2-enyl)-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine |
|---|---|
| PubChem CID | 67909385 |
| Molecular Formula | C21H25Cl2N3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-4-(3-methylbut-2-enyl)-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine |
| SMILES | CC(C)=CCN1Cc2cccc(N)c2NCC1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2N3/c1-14(2)8-9-26-13-16-4-3-5-20(24)21(16)25-12-17(26)10-15-6-7-18(22)19(23)11-15/h3-8,11,17,25H,9-10,12-13,24H2,1-2H3 |
| InChIKey | ZVXJBUUNTCBRFG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|