C16H19Cl2N3S — CID 21251949
5,6-dichloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione (PubChem CID 21251949) has the molecular formula C16H19Cl2N3S and a molecular weight of 356.32 g/mol. Its IUPAC name is 5,6-dichloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione.
| Compound Name | 5,6-dichloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione |
|---|---|
| PubChem CID | 21251949 |
| Molecular Formula | C16H19Cl2N3S |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 5,6-dichloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione |
| SMILES | CC(C)=CCN1Cc2cc(Cl)c(Cl)c3[nH]c(=S)n(c23)CC1C |
| InChI | InChI=1S/C16H19Cl2N3S/c1-9(2)4-5-20-8-11-6-12(17)13(18)14-15(11)21(7-10(20)3)16(22)19-14/h4,6,10H,5,7-8H2,1-3H3,(H,19,22) |
| InChIKey | ROQNJTBXZCAOED-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|