C17H22ClN3S — CID 22869644
(11S)-7-chloro-10-[(E)-hex-2-enyl]-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione (PubChem CID 22869644) has the molecular formula C17H22ClN3S and a molecular weight of 335.90 g/mol. Its IUPAC name is (11S)-7-chloro-10-[(E)-hex-2-enyl]-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione.
| Compound Name | (11S)-7-chloro-10-[(E)-hex-2-enyl]-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione |
|---|---|
| PubChem CID | 22869644 |
| Molecular Formula | C17H22ClN3S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (11S)-7-chloro-10-[(E)-hex-2-enyl]-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione |
| SMILES | CCC/C=C/CN1Cc2c(Cl)ccc3[nH]c(=S)n(c23)C[C@@H]1C |
| InChI | InChI=1S/C17H22ClN3S/c1-3-4-5-6-9-20-11-13-14(18)7-8-15-16(13)21(10-12(20)2)17(22)19-15/h5-8,12H,3-4,9-11H2,1-2H3,(H,19,22)/b6-5+/t12-/m0/s1 |
| InChIKey | FYNNRDIAYGTKNH-FYJFLYSWSA-N |
| XLogP | 4.91 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|