C35H43N5O4 — CID 67910211
[2-[4-[[2-butyl-5-[butyl(cyclohexylcarbamoyl)amino]imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67910211) has the molecular formula C35H43N5O4 and a molecular weight of 597.76 g/mol. Its IUPAC name is [2-[4-[[2-butyl-5-[butyl(cyclohexylcarbamoyl)amino]imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[2-butyl-5-[butyl(cyclohexylcarbamoyl)amino]imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67910211 |
| Molecular Formula | C35H43N5O4 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | [2-[4-[[2-butyl-5-[butyl(cyclohexylcarbamoyl)amino]imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCc1nc2ccc(N(CCCC)C(=O)NC3CCCCC3)nc2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C35H43N5O4/c1-3-5-16-31-37-29-21-22-32(39(23-6-4-2)34(41)36-27-12-8-7-9-13-27)38-33(29)40(31)24-25-17-19-26(20-18-25)28-14-10-11-15-30(28)44-35(42)43/h10-11,14-15,17-22,27H,3-9,12-13,16,23-24H2,1-2H3,(H,36,41)(H,42,43) |
| InChIKey | ADHSKDFBMMTVPF-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|