C12H10ClF3N2O — CID 67910277
5-chloro-5-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one (PubChem CID 67910277) has the molecular formula C12H10ClF3N2O and a molecular weight of 290.67 g/mol. Its IUPAC name is 5-chloro-5-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-5-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 67910277 |
| Molecular Formula | C12H10ClF3N2O |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 5-chloro-5-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one |
| SMILES | CC1(Cl)C=CN(c2cccc(C(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C12H10ClF3N2O/c1-11(13)5-6-18(17-10(11)19)9-4-2-3-8(7-9)12(14,15)16/h2-7H,1H3,(H,17,19) |
| InChIKey | ZDTGNDLCQQDUJK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|