C21H24N2O4 — CID 67914564
[2-[(1-benzyl-3-hydroxypiperidin-4-yl)carbamoyl]phenyl] acetate (PubChem CID 67914564) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is [2-[(1-benzyl-3-hydroxypiperidin-4-yl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[(1-benzyl-3-hydroxypiperidin-4-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 67914564 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [2-[(1-benzyl-3-hydroxypiperidin-4-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NC1CCN(Cc2ccccc2)CC1O |
| InChI | InChI=1S/C21H24N2O4/c1-15(24)27-20-10-6-5-9-17(20)21(26)22-18-11-12-23(14-19(18)25)13-16-7-3-2-4-8-16/h2-10,18-19,25H,11-14H2,1H3,(H,22,26) |
| InChIKey | WZAIMBHYSHIKTI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|