C18H22N2O4 — CID 67915372
5-acetyl-1-hexan-2-yl-3-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 67915372) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-acetyl-1-hexan-2-yl-3-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-acetyl-1-hexan-2-yl-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67915372 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-acetyl-1-hexan-2-yl-3-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCC(C)N1C(=O)C(C(C)=O)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H22N2O4/c1-4-5-9-12(2)19-16(22)15(13(3)21)17(23)20(18(19)24)14-10-7-6-8-11-14/h6-8,10-12,15H,4-5,9H2,1-3H3 |
| InChIKey | GREYVUBVZWORKW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|