C16H16N2NiO2 — CID 6791662
nickel;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 6791662) has the molecular formula C16H16N2NiO2 and a molecular weight of 327.01 g/mol. Its IUPAC name is nickel;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | nickel;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 6791662 |
| Molecular Formula | C16H16N2NiO2 |
| Molecular Weight | 327.01 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | nickel;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1=CNCCNC=C1C=CC=CC1=O.[Ni] |
| InChI | InChI=1S/C16H16N2O2.Ni/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,17-18H,9-10H2; |
| InChIKey | AHGSKSYDMRZICE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.01 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|