C18H20N2O4 — CID 67916624
2-amino-4-[[(S)-carboxy(phenyl)methyl]amino]-3-phenylbutanoic acid (PubChem CID 67916624) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-amino-4-[[(S)-carboxy(phenyl)methyl]amino]-3-phenylbutanoic acid.
| Compound Name | 2-amino-4-[[(S)-carboxy(phenyl)methyl]amino]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 67916624 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-amino-4-[[(S)-carboxy(phenyl)methyl]amino]-3-phenylbutanoic acid |
| SMILES | NC(C(=O)O)C(CN[C@H](C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4/c19-15(17(21)22)14(12-7-3-1-4-8-12)11-20-16(18(23)24)13-9-5-2-6-10-13/h1-10,14-16,20H,11,19H2,(H,21,22)(H,23,24)/t14?,15?,16-/m0/s1 |
| InChIKey | JQGFOIXVKSZNJX-GPANFISMSA-N |
| XLogP | 1.60 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |