C30H34O6 — CID 67918956
phenyl 5-decoxy-2-(4-hydroxybenzoyl)oxybenzoate (PubChem CID 67918956) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is phenyl 5-decoxy-2-(4-hydroxybenzoyl)oxybenzoate.
| Compound Name | phenyl 5-decoxy-2-(4-hydroxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 67918956 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | phenyl 5-decoxy-2-(4-hydroxybenzoyl)oxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)c2ccc(O)cc2)c(C(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C30H34O6/c1-2-3-4-5-6-7-8-12-21-34-26-19-20-28(36-29(32)23-15-17-24(31)18-16-23)27(22-26)30(33)35-25-13-10-9-11-14-25/h9-11,13-20,22,31H,2-8,12,21H2,1H3 |
| InChIKey | YISOTERAPHBOST-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|