C28H52O3 — CID 67921315
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 67921315) has the molecular formula C28H52O3 and a molecular weight of 436.72 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 67921315 |
| Molecular Formula | C28H52O3 |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 436.39 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C28H52O3/c1-5-6-7-14-17-25(29)18-15-12-10-8-9-11-13-16-19-28(30)31-27-22-24(4)20-21-26(27)23(2)3/h12,15,23-27,29H,5-11,13-14,16-22H2,1-4H3/b15-12-/t24-,25-,26+,27-/m1/s1 |
| InChIKey | NVMUIBLIHPPGJV-BCWDRBFHSA-N |
| XLogP | 8.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|