C9H15NO3 — CID 67923409
(2-propan-2-yl-1,3-oxazolidin-3-yl) prop-2-enoate (PubChem CID 67923409) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (2-propan-2-yl-1,3-oxazolidin-3-yl) prop-2-enoate.
| Compound Name | (2-propan-2-yl-1,3-oxazolidin-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 67923409 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (2-propan-2-yl-1,3-oxazolidin-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)ON1CCOC1C(C)C |
| InChI | InChI=1S/C9H15NO3/c1-4-8(11)13-10-5-6-12-9(10)7(2)3/h4,7,9H,1,5-6H2,2-3H3 |
| InChIKey | AQLCDYRJKFFKIQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|