C15H16O2 — CID 67923705
3-benzyl-2,3,4a,8a-tetrahydro-1,4-benzodioxine (PubChem CID 67923705) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-benzyl-2,3,4a,8a-tetrahydro-1,4-benzodioxine.
| Compound Name | 3-benzyl-2,3,4a,8a-tetrahydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 67923705 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-benzyl-2,3,4a,8a-tetrahydro-1,4-benzodioxine |
| SMILES | C1=CC2OCC(Cc3ccccc3)OC2C=C1 |
| InChI | InChI=1S/C15H16O2/c1-2-6-12(7-3-1)10-13-11-16-14-8-4-5-9-15(14)17-13/h1-9,13-15H,10-11H2 |
| InChIKey | NZCNKOIVCGLALR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |