C17H27NO4S — CID 67924003
2-[bis(2-methoxyethyl)amino]-2-methyl-1-(4-methylsulfinylphenyl)propan-1-one (PubChem CID 67924003) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)amino]-2-methyl-1-(4-methylsulfinylphenyl)propan-1-one.
| Compound Name | 2-[bis(2-methoxyethyl)amino]-2-methyl-1-(4-methylsulfinylphenyl)propan-1-one |
|---|---|
| PubChem CID | 67924003 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-[bis(2-methoxyethyl)amino]-2-methyl-1-(4-methylsulfinylphenyl)propan-1-one |
| SMILES | COCCN(CCOC)C(C)(C)C(=O)c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C17H27NO4S/c1-17(2,18(10-12-21-3)11-13-22-4)16(19)14-6-8-15(9-7-14)23(5)20/h6-9H,10-13H2,1-5H3 |
| InChIKey | PPBLHDNVERXWRS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |